C28H24N2O3 — CID 4933138
N'-(2,2-diphenylacetyl)-4-phenylmethoxybenzohydrazide (PubChem CID 4933138) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is N'-(2,2-diphenylacetyl)-4-phenylmethoxybenzohydrazide.
| Compound Name | N'-(2,2-diphenylacetyl)-4-phenylmethoxybenzohydrazide |
|---|---|
| PubChem CID | 4933138 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N'-(2,2-diphenylacetyl)-4-phenylmethoxybenzohydrazide |
| SMILES | O=C(NNC(=O)C(c1ccccc1)c1ccccc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N2O3/c31-27(24-16-18-25(19-17-24)33-20-21-10-4-1-5-11-21)29-30-28(32)26(22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19,26H,20H2,(H,29,31)(H,30,32) |
| InChIKey | DNPJNSMORULBSL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|