C17H11ClN2O5 — CID 55999322
[2-(furan-2-carbonylamino)-2-oxoethyl] 2-chloroquinoline-6-carboxylate (PubChem CID 55999322) has the molecular formula C17H11ClN2O5 and a molecular weight of 358.74 g/mol. Its IUPAC name is [2-(furan-2-carbonylamino)-2-oxoethyl] 2-chloroquinoline-6-carboxylate.
| Compound Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55999322 |
| Molecular Formula | C17H11ClN2O5 |
| Molecular Weight | 358.74 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2nc(Cl)ccc2c1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C17H11ClN2O5/c18-14-6-4-10-8-11(3-5-12(10)19-14)17(23)25-9-15(21)20-16(22)13-2-1-7-24-13/h1-8H,9H2,(H,20,21,22) |
| InChIKey | GWLZXPBYENMVQZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.74 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|