About (2-benzamido-2-oxoethyl) furan-2-carboxylate
(2-benzamido-2-oxoethyl) furan-2-carboxylate (PubChem CID 7486704) has the molecular formula C14H11NO5
and a molecular weight of 273.24 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) furan-2-carboxylate.
Molecular Properties
| Compound Name | (2-benzamido-2-oxoethyl) furan-2-carboxylate |
| PubChem CID | 7486704 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (2-benzamido-2-oxoethyl) furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccco1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H11NO5/c16-12(9-20-14(18)11-7-4-8-19-11)15-13(17)10-5-2-1-3-6-10/h1-8H,9H2,(H,15,16,17) |
| InChIKey | CBWHZXMIZOSJGM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-benzamido-2-oxoethyl) furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzamido-2-oxoethyl) furan-2-carboxylate?
The IUPAC name of (2-benzamido-2-oxoethyl) furan-2-carboxylate (CID 7486704) is (2-benzamido-2-oxoethyl) furan-2-carboxylate.
What is the SMILES notation for (2-benzamido-2-oxoethyl) furan-2-carboxylate?
The canonical SMILES for (2-benzamido-2-oxoethyl) furan-2-carboxylate is O=C(COC(=O)c1ccco1)NC(=O)c1ccccc1.
What is the InChIKey of (2-benzamido-2-oxoethyl) furan-2-carboxylate?
The InChIKey is CBWHZXMIZOSJGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO5/c16-12(9-20-14(18)11-7-4-8-19-11)15-13(17)10-5-2-1-3-6-10/h1-8H,9H2,(H,15,16,17).
What are the key properties of (2-benzamido-2-oxoethyl) furan-2-carboxylate?
(2-benzamido-2-oxoethyl) furan-2-carboxylate has a molecular weight of 273.24 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzamido-2-oxoethyl) furan-2-carboxylate is sourced from PubChem (CID 7486704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).