C20H16N2O6 — CID 7985162
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 3-phenoxybenzoate (PubChem CID 7985162) has the molecular formula C20H16N2O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 3-phenoxybenzoate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 3-phenoxybenzoate |
|---|---|
| PubChem CID | 7985162 |
| Molecular Formula | C20H16N2O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 3-phenoxybenzoate |
| SMILES | O=C(COC(=O)c1cccc(Oc2ccccc2)c1)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C20H16N2O6/c23-18(21-22-19(24)17-10-5-11-26-17)13-27-20(25)14-6-4-9-16(12-14)28-15-7-2-1-3-8-15/h1-12H,13H2,(H,21,23)(H,22,24) |
| InChIKey | JJLCCQQKJFICIU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|