C13H11N3O5 — CID 7783774
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] pyridine-4-carboxylate (PubChem CID 7783774) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] pyridine-4-carboxylate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 7783774 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] pyridine-4-carboxylate |
| SMILES | O=C(COC(=O)c1ccncc1)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C13H11N3O5/c17-11(15-16-12(18)10-2-1-7-20-10)8-21-13(19)9-3-5-14-6-4-9/h1-7H,8H2,(H,15,17)(H,16,18) |
| InChIKey | JEXXISUGVQNVRZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|