C14H10BrFN2O5 — CID 9387892
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 4-bromo-2-fluorobenzoate (PubChem CID 9387892) has the molecular formula C14H10BrFN2O5 and a molecular weight of 385.15 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 4-bromo-2-fluorobenzoate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 4-bromo-2-fluorobenzoate |
|---|---|
| PubChem CID | 9387892 |
| Molecular Formula | C14H10BrFN2O5 |
| Molecular Weight | 385.15 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 4-bromo-2-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Br)cc1F)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C14H10BrFN2O5/c15-8-3-4-9(10(16)6-8)14(21)23-7-12(19)17-18-13(20)11-2-1-5-22-11/h1-6H,7H2,(H,17,19)(H,18,20) |
| InChIKey | IVPSIORVXSTTMS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.15 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|