C14H11FN2O5 — CID 8612232
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 3-fluorobenzoate (PubChem CID 8612232) has the molecular formula C14H11FN2O5 and a molecular weight of 306.25 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 3-fluorobenzoate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 8612232 |
| Molecular Formula | C14H11FN2O5 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 3-fluorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(F)c1)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C14H11FN2O5/c15-10-4-1-3-9(7-10)14(20)22-8-12(18)16-17-13(19)11-5-2-6-21-11/h1-7H,8H2,(H,16,18)(H,17,19) |
| InChIKey | IYQSWIPUIVOHBO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|