C12H9ClN2O5S — CID 7146656
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 5-chlorothiophene-2-carboxylate (PubChem CID 7146656) has the molecular formula C12H9ClN2O5S and a molecular weight of 328.73 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 5-chlorothiophene-2-carboxylate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 5-chlorothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7146656 |
| Molecular Formula | C12H9ClN2O5S |
| Molecular Weight | 328.73 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 5-chlorothiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(Cl)s1)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C12H9ClN2O5S/c13-9-4-3-8(21-9)12(18)20-6-10(16)14-15-11(17)7-2-1-5-19-7/h1-5H,6H2,(H,14,16)(H,15,17) |
| InChIKey | UNVLFFFRDABIAP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.73 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|