C13H10Cl3N4O5+ — CID 7633673
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate (PubChem CID 7633673) has the molecular formula C13H10Cl3N4O5+ and a molecular weight of 408.61 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 7633673 |
| Molecular Formula | C13H10Cl3N4O5+ |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 4-amino-3,5,6-trichloropyridin-1-ium-2-carboxylate |
| SMILES | Nc1c(Cl)c(Cl)[nH+]c(C(=O)OCC(=O)NNC(=O)c2ccco2)c1Cl |
| InChI | InChI=1S/C13H9Cl3N4O5/c14-7-9(17)8(15)11(16)18-10(7)13(23)25-4-6(21)19-20-12(22)5-2-1-3-24-5/h1-3H,4H2,(H2,17,18)(H,19,21)(H,20,22)/p+1 |
| InChIKey | OOVJRXVTABHXNO-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 137.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|