C15H12Cl2N2O6 — CID 9125715
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 3,5-dichloro-4-methoxybenzoate (PubChem CID 9125715) has the molecular formula C15H12Cl2N2O6 and a molecular weight of 387.18 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 3,5-dichloro-4-methoxybenzoate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 3,5-dichloro-4-methoxybenzoate |
|---|---|
| PubChem CID | 9125715 |
| Molecular Formula | C15H12Cl2N2O6 |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 3,5-dichloro-4-methoxybenzoate |
| SMILES | COc1c(Cl)cc(C(=O)OCC(=O)NNC(=O)c2ccco2)cc1Cl |
| InChI | InChI=1S/C15H12Cl2N2O6/c1-23-13-9(16)5-8(6-10(13)17)15(22)25-7-12(20)18-19-14(21)11-3-2-4-24-11/h2-6H,7H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | VAKKMOWHKJXMAJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|