C16H15BrN2O6 — CID 9063759
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-(2-bromo-4-methylphenoxy)acetate (PubChem CID 9063759) has the molecular formula C16H15BrN2O6 and a molecular weight of 411.21 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-(2-bromo-4-methylphenoxy)acetate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-(2-bromo-4-methylphenoxy)acetate |
|---|---|
| PubChem CID | 9063759 |
| Molecular Formula | C16H15BrN2O6 |
| Molecular Weight | 411.21 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-(2-bromo-4-methylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)OCC(=O)NNC(=O)c2ccco2)c(Br)c1 |
| InChI | InChI=1S/C16H15BrN2O6/c1-10-4-5-12(11(17)7-10)24-9-15(21)25-8-14(20)18-19-16(22)13-3-2-6-23-13/h2-7H,8-9H2,1H3,(H,18,20)(H,19,22) |
| InChIKey | AABSGWCBTGZABT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|