C17H18N2O6 — CID 7981951
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-(2,3-dimethylphenoxy)acetate (PubChem CID 7981951) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-(2,3-dimethylphenoxy)acetate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-(2,3-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 7981951 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] 2-(2,3-dimethylphenoxy)acetate |
| SMILES | Cc1cccc(OCC(=O)OCC(=O)NNC(=O)c2ccco2)c1C |
| InChI | InChI=1S/C17H18N2O6/c1-11-5-3-6-13(12(11)2)24-10-16(21)25-9-15(20)18-19-17(22)14-7-4-8-23-14/h3-8H,9-10H2,1-2H3,(H,18,20)(H,19,22) |
| InChIKey | FTNYCYZLRMHDRT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|