C16H15BrFNO5 — CID 8846429
[2-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 2-(2-bromo-4-fluorophenoxy)acetate (PubChem CID 8846429) has the molecular formula C16H15BrFNO5 and a molecular weight of 400.20 g/mol. Its IUPAC name is [2-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 2-(2-bromo-4-fluorophenoxy)acetate.
| Compound Name | [2-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 2-(2-bromo-4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 8846429 |
| Molecular Formula | C16H15BrFNO5 |
| Molecular Weight | 400.20 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | [2-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 2-(2-bromo-4-fluorophenoxy)acetate |
| SMILES | C[C@H](NC(=O)COC(=O)COc1ccc(F)cc1Br)c1ccco1 |
| InChI | InChI=1S/C16H15BrFNO5/c1-10(13-3-2-6-22-13)19-15(20)8-24-16(21)9-23-14-5-4-11(18)7-12(14)17/h2-7,10H,8-9H2,1H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | UPNMGHMGTGUKRB-JTQLQIEISA-N |
| XLogP | 2.98 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |