C18H16BrNO5 — CID 9063804
(2-benzamido-2-oxoethyl) 2-(2-bromo-4-methylphenoxy)acetate (PubChem CID 9063804) has the molecular formula C18H16BrNO5 and a molecular weight of 406.23 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2-(2-bromo-4-methylphenoxy)acetate.
| Compound Name | (2-benzamido-2-oxoethyl) 2-(2-bromo-4-methylphenoxy)acetate |
|---|---|
| PubChem CID | 9063804 |
| Molecular Formula | C18H16BrNO5 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2-(2-bromo-4-methylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)OCC(=O)NC(=O)c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C18H16BrNO5/c1-12-7-8-15(14(19)9-12)24-11-17(22)25-10-16(21)20-18(23)13-5-3-2-4-6-13/h2-9H,10-11H2,1H3,(H,20,21,23) |
| InChIKey | XCVKULXOKZWQHT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |