C14H12Br2N2O4 — CID 3931565
N'-[2-(2,4-dibromophenoxy)acetyl]-2-methylfuran-3-carbohydrazide (PubChem CID 3931565) has the molecular formula C14H12Br2N2O4 and a molecular weight of 432.07 g/mol. Its IUPAC name is N'-[2-(2,4-dibromophenoxy)acetyl]-2-methylfuran-3-carbohydrazide.
| Compound Name | N'-[2-(2,4-dibromophenoxy)acetyl]-2-methylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 3931565 |
| Molecular Formula | C14H12Br2N2O4 |
| Molecular Weight | 432.07 g/mol |
| Exact Mass | 429.92 |
| IUPAC Name | N'-[2-(2,4-dibromophenoxy)acetyl]-2-methylfuran-3-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H12Br2N2O4/c1-8-10(4-5-21-8)14(20)18-17-13(19)7-22-12-3-2-9(15)6-11(12)16/h2-6H,7H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | NQTNZXXMSJTXQU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.07 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|