C17H15Br3N2O4 — CID 17353057
5-bromo-N'-[2-(2,4-dibromophenoxy)acetyl]-2-ethoxybenzohydrazide (PubChem CID 17353057) has the molecular formula C17H15Br3N2O4 and a molecular weight of 551.03 g/mol. Its IUPAC name is 5-bromo-N'-[2-(2,4-dibromophenoxy)acetyl]-2-ethoxybenzohydrazide.
| Compound Name | 5-bromo-N'-[2-(2,4-dibromophenoxy)acetyl]-2-ethoxybenzohydrazide |
|---|---|
| PubChem CID | 17353057 |
| Molecular Formula | C17H15Br3N2O4 |
| Molecular Weight | 551.03 g/mol |
| Exact Mass | 547.86 |
| IUPAC Name | 5-bromo-N'-[2-(2,4-dibromophenoxy)acetyl]-2-ethoxybenzohydrazide |
| SMILES | CCOc1ccc(Br)cc1C(=O)NNC(=O)COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C17H15Br3N2O4/c1-2-25-14-5-3-10(18)7-12(14)17(24)22-21-16(23)9-26-15-6-4-11(19)8-13(15)20/h3-8H,2,9H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | KXWQEBMGROSNKN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.03 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|