C13H17BrN2O4 — CID 17140940
5-bromo-2-ethoxy-N'-(2-ethoxyacetyl)benzohydrazide (PubChem CID 17140940) has the molecular formula C13H17BrN2O4 and a molecular weight of 345.19 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N'-(2-ethoxyacetyl)benzohydrazide.
| Compound Name | 5-bromo-2-ethoxy-N'-(2-ethoxyacetyl)benzohydrazide |
|---|---|
| PubChem CID | 17140940 |
| Molecular Formula | C13H17BrN2O4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 5-bromo-2-ethoxy-N'-(2-ethoxyacetyl)benzohydrazide |
| SMILES | CCOCC(=O)NNC(=O)c1cc(Br)ccc1OCC |
| InChI | InChI=1S/C13H17BrN2O4/c1-3-19-8-12(17)15-16-13(18)10-7-9(14)5-6-11(10)20-4-2/h5-7H,3-4,8H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | WZARJLCWKXFOBX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|