C13H16BrN3O4S — CID 17141042
5-bromo-N-[[(2-ethoxyacetyl)amino]carbamothioyl]-2-methoxybenzamide (PubChem CID 17141042) has the molecular formula C13H16BrN3O4S and a molecular weight of 390.26 g/mol. Its IUPAC name is 5-bromo-N-[[(2-ethoxyacetyl)amino]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[[(2-ethoxyacetyl)amino]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 17141042 |
| Molecular Formula | C13H16BrN3O4S |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 5-bromo-N-[[(2-ethoxyacetyl)amino]carbamothioyl]-2-methoxybenzamide |
| SMILES | CCOCC(=O)NNC(=S)NC(=O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C13H16BrN3O4S/c1-3-21-7-11(18)16-17-13(22)15-12(19)9-6-8(14)4-5-10(9)20-2/h4-6H,3,7H2,1-2H3,(H,16,18)(H2,15,17,19,22) |
| InChIKey | FYLHPGHSTJBEQG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|