C19H17BrN4O3S — CID 17094705
5-bromo-N-[[(2-indol-1-ylacetyl)amino]carbamothioyl]-2-methoxybenzamide (PubChem CID 17094705) has the molecular formula C19H17BrN4O3S and a molecular weight of 461.34 g/mol. Its IUPAC name is 5-bromo-N-[[(2-indol-1-ylacetyl)amino]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[[(2-indol-1-ylacetyl)amino]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 17094705 |
| Molecular Formula | C19H17BrN4O3S |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 5-bromo-N-[[(2-indol-1-ylacetyl)amino]carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Br)cc1C(=O)NC(=S)NNC(=O)Cn1ccc2ccccc21 |
| InChI | InChI=1S/C19H17BrN4O3S/c1-27-16-7-6-13(20)10-14(16)18(26)21-19(28)23-22-17(25)11-24-9-8-12-4-2-3-5-15(12)24/h2-10H,11H2,1H3,(H,22,25)(H2,21,23,26,28) |
| InChIKey | SQBQKOFVERODFK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|