C18H15FN4O2S — CID 17080473
2-fluoro-N-[[(2-indol-1-ylacetyl)amino]carbamothioyl]benzamide (PubChem CID 17080473) has the molecular formula C18H15FN4O2S and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-fluoro-N-[[(2-indol-1-ylacetyl)amino]carbamothioyl]benzamide.
| Compound Name | 2-fluoro-N-[[(2-indol-1-ylacetyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17080473 |
| Molecular Formula | C18H15FN4O2S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-fluoro-N-[[(2-indol-1-ylacetyl)amino]carbamothioyl]benzamide |
| SMILES | O=C(Cn1ccc2ccccc21)NNC(=S)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C18H15FN4O2S/c19-14-7-3-2-6-13(14)17(25)20-18(26)22-21-16(24)11-23-10-9-12-5-1-4-8-15(12)23/h1-10H,11H2,(H,21,24)(H2,20,22,25,26) |
| InChIKey | MCLFGMALSUMCOF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|