C21H21FN4O3 — CID 3336665
N-[(4-fluorophenyl)methyl]-4-[2-(2-indol-1-ylacetyl)hydrazinyl]-4-oxobutanamide (PubChem CID 3336665) has the molecular formula C21H21FN4O3 and a molecular weight of 396.42 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-[2-(2-indol-1-ylacetyl)hydrazinyl]-4-oxobutanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-[2-(2-indol-1-ylacetyl)hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 3336665 |
| Molecular Formula | C21H21FN4O3 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-[2-(2-indol-1-ylacetyl)hydrazinyl]-4-oxobutanamide |
| SMILES | O=C(CCC(=O)NNC(=O)Cn1ccc2ccccc21)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN4O3/c22-17-7-5-15(6-8-17)13-23-19(27)9-10-20(28)24-25-21(29)14-26-12-11-16-3-1-2-4-18(16)26/h1-8,11-12H,9-10,13-14H2,(H,23,27)(H,24,28)(H,25,29) |
| InChIKey | FTGIMZWVCUGNBC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|