C18H15N3O4 — CID 17080252
2-[[(2-indol-1-ylacetyl)amino]carbamoyl]benzoic acid (PubChem CID 17080252) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-[[(2-indol-1-ylacetyl)amino]carbamoyl]benzoic acid.
| Compound Name | 2-[[(2-indol-1-ylacetyl)amino]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 17080252 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-[[(2-indol-1-ylacetyl)amino]carbamoyl]benzoic acid |
| SMILES | O=C(Cn1ccc2ccccc21)NNC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C18H15N3O4/c22-16(11-21-10-9-12-5-1-4-8-15(12)21)19-20-17(23)13-6-2-3-7-14(13)18(24)25/h1-10H,11H2,(H,19,22)(H,20,23)(H,24,25) |
| InChIKey | GALCOSNUBIDWAA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|