C19H17N2O3- — CID 9292192
4-[(3-indol-1-ylpropanoylamino)methyl]benzoate (PubChem CID 9292192) has the molecular formula C19H17N2O3- and a molecular weight of 321.36 g/mol. Its IUPAC name is 4-[(3-indol-1-ylpropanoylamino)methyl]benzoate.
| Compound Name | 4-[(3-indol-1-ylpropanoylamino)methyl]benzoate |
|---|---|
| PubChem CID | 9292192 |
| Molecular Formula | C19H17N2O3- |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-[(3-indol-1-ylpropanoylamino)methyl]benzoate |
| SMILES | O=C(CCn1ccc2ccccc21)NCc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C19H18N2O3/c22-18(20-13-14-5-7-16(8-6-14)19(23)24)10-12-21-11-9-15-3-1-2-4-17(15)21/h1-9,11H,10,12-13H2,(H,20,22)(H,23,24)/p-1 |
| InChIKey | PSAWQSBKMARACC-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |