C21H20N4O2 — CID 31830439
3-indol-1-yl-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide (PubChem CID 31830439) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 3-indol-1-yl-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide.
| Compound Name | 3-indol-1-yl-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 31830439 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3-indol-1-yl-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide |
| SMILES | O=C(CCn1ccc2ccccc21)NNC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H20N4O2/c26-20(10-12-25-11-9-15-5-1-4-8-19(15)25)23-24-21(27)13-16-14-22-18-7-3-2-6-17(16)18/h1-9,11,14,22H,10,12-13H2,(H,23,26)(H,24,27) |
| InChIKey | GWLCHOAZWLRWJF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|