C20H18N6O3 — CID 39430911
N'-[2-(1H-indol-3-yl)acetyl]-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanehydrazide (PubChem CID 39430911) has the molecular formula C20H18N6O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)acetyl]-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanehydrazide.
| Compound Name | N'-[2-(1H-indol-3-yl)acetyl]-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanehydrazide |
|---|---|
| PubChem CID | 39430911 |
| Molecular Formula | C20H18N6O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)acetyl]-3-(4-oxo-1,2,3-benzotriazin-3-yl)propanehydrazide |
| SMILES | O=C(CCn1nnc2ccccc2c1=O)NNC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H18N6O3/c27-18(9-10-26-20(29)15-6-2-4-8-17(15)22-25-26)23-24-19(28)11-13-12-21-16-7-3-1-5-14(13)16/h1-8,12,21H,9-11H2,(H,23,27)(H,24,28) |
| InChIKey | ZOXPNUMNKACTBN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|