C25H20N4O3 — CID 31860262
2-(1H-indol-3-yl)-N'-[2-(9-oxoacridin-10-yl)acetyl]acetohydrazide (PubChem CID 31860262) has the molecular formula C25H20N4O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N'-[2-(9-oxoacridin-10-yl)acetyl]acetohydrazide.
| Compound Name | 2-(1H-indol-3-yl)-N'-[2-(9-oxoacridin-10-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 31860262 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-(1H-indol-3-yl)-N'-[2-(9-oxoacridin-10-yl)acetyl]acetohydrazide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NNC(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C25H20N4O3/c30-23(13-16-14-26-20-10-4-1-7-17(16)20)27-28-24(31)15-29-21-11-5-2-8-18(21)25(32)19-9-3-6-12-22(19)29/h1-12,14,26H,13,15H2,(H,27,30)(H,28,31) |
| InChIKey | GQWZWCMPFYKLGF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|