C23H23N5O4 — CID 46656981
2-(1H-indol-3-yl)-N'-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]acetohydrazide (PubChem CID 46656981) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N'-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]acetohydrazide.
| Compound Name | 2-(1H-indol-3-yl)-N'-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]acetohydrazide |
|---|---|
| PubChem CID | 46656981 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-(1H-indol-3-yl)-N'-[2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetyl]acetohydrazide |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CC(=O)NNC(=O)Cc3c[nH]c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C23H23N5O4/c1-14-7-9-16(10-8-14)23(2)21(31)28(22(32)25-23)13-20(30)27-26-19(29)11-15-12-24-18-6-4-3-5-17(15)18/h3-10,12,24H,11,13H2,1-2H3,(H,25,32)(H,26,29)(H,27,30) |
| InChIKey | NZRWEEIDJOMYCZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|