C23H22N4O4 — CID 32795936
N'-[2-(1H-indol-3-yl)acetyl]-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanehydrazide (PubChem CID 32795936) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)acetyl]-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanehydrazide.
| Compound Name | N'-[2-(1H-indol-3-yl)acetyl]-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanehydrazide |
|---|---|
| PubChem CID | 32795936 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)acetyl]-4-(5-methyl-1,3-dioxoisoindol-2-yl)butanehydrazide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)NNC(=O)Cc1c[nH]c3ccccc13)C2=O |
| InChI | InChI=1S/C23H22N4O4/c1-14-8-9-17-18(11-14)23(31)27(22(17)30)10-4-7-20(28)25-26-21(29)12-15-13-24-19-6-3-2-5-16(15)19/h2-3,5-6,8-9,11,13,24H,4,7,10,12H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | DVHWLRHWRVQTFB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|