C20H21N3O5 — CID 55375532
2,5-dimethyl-N'-[4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoyl]furan-3-carbohydrazide (PubChem CID 55375532) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 2,5-dimethyl-N'-[4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoyl]furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-[4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 55375532 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2,5-dimethyl-N'-[4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoyl]furan-3-carbohydrazide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)NNC(=O)c1cc(C)oc1C)C2=O |
| InChI | InChI=1S/C20H21N3O5/c1-11-6-7-14-16(9-11)20(27)23(19(14)26)8-4-5-17(24)21-22-18(25)15-10-12(2)28-13(15)3/h6-7,9-10H,4-5,8H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | WGPOMBGOMMIKGV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|