C25H29N3O7 — CID 34250803
3,4,5-triethoxy-N'-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoyl]benzohydrazide (PubChem CID 34250803) has the molecular formula C25H29N3O7 and a molecular weight of 483.52 g/mol. Its IUPAC name is 3,4,5-triethoxy-N'-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoyl]benzohydrazide.
| Compound Name | 3,4,5-triethoxy-N'-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 34250803 |
| Molecular Formula | C25H29N3O7 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 3,4,5-triethoxy-N'-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoyl]benzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)CCN2C(=O)c3ccc(C)cc3C2=O)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H29N3O7/c1-5-33-19-13-16(14-20(34-6-2)22(19)35-7-3)23(30)27-26-21(29)10-11-28-24(31)17-9-8-15(4)12-18(17)25(28)32/h8-9,12-14H,5-7,10-11H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | PYUAVXJBRIMTPZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|