C19H17N3O4 — CID 2672371
N'-[3-(1,3-dioxoisoindol-2-yl)propanoyl]-4-methylbenzohydrazide (PubChem CID 2672371) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is N'-[3-(1,3-dioxoisoindol-2-yl)propanoyl]-4-methylbenzohydrazide.
| Compound Name | N'-[3-(1,3-dioxoisoindol-2-yl)propanoyl]-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 2672371 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N'-[3-(1,3-dioxoisoindol-2-yl)propanoyl]-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C19H17N3O4/c1-12-6-8-13(9-7-12)17(24)21-20-16(23)10-11-22-18(25)14-4-2-3-5-15(14)19(22)26/h2-9H,10-11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | UXFCHLUJMVCIJG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|