C18H13N3O6 — CID 21108836
4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]carbamoyl]benzoic acid (PubChem CID 21108836) has the molecular formula C18H13N3O6 and a molecular weight of 367.32 g/mol. Its IUPAC name is 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]carbamoyl]benzoic acid.
| Compound Name | 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 21108836 |
| Molecular Formula | C18H13N3O6 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 4-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]carbamoyl]benzoic acid |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)NNC(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H13N3O6/c22-14(9-21-16(24)12-3-1-2-4-13(12)17(21)25)19-20-15(23)10-5-7-11(8-6-10)18(26)27/h1-8H,9H2,(H,19,22)(H,20,23)(H,26,27) |
| InChIKey | MQMNHYUSMFEMEX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|