C13H13N3O5 — CID 594911
ethyl N-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]carbamate (PubChem CID 594911) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is ethyl N-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]carbamate.
| Compound Name | ethyl N-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]carbamate |
|---|---|
| PubChem CID | 594911 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | ethyl N-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H13N3O5/c1-2-21-13(20)15-14-10(17)7-16-11(18)8-5-3-4-6-9(8)12(16)19/h3-6H,2,7H2,1H3,(H,14,17)(H,15,20) |
| InChIKey | BBFRLHKWZCZTAV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|