C17H17NO7 — CID 594859
diethyl 2-[2-(1,3-dioxoisoindol-2-yl)acetyl]propanedioate (PubChem CID 594859) has the molecular formula C17H17NO7 and a molecular weight of 347.32 g/mol. Its IUPAC name is diethyl 2-[2-(1,3-dioxoisoindol-2-yl)acetyl]propanedioate.
| Compound Name | diethyl 2-[2-(1,3-dioxoisoindol-2-yl)acetyl]propanedioate |
|---|---|
| PubChem CID | 594859 |
| Molecular Formula | C17H17NO7 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | diethyl 2-[2-(1,3-dioxoisoindol-2-yl)acetyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)CN1C(=O)c2ccccc2C1=O)C(=O)OCC |
| InChI | InChI=1S/C17H17NO7/c1-3-24-16(22)13(17(23)25-4-2)12(19)9-18-14(20)10-7-5-6-8-11(10)15(18)21/h5-8,13H,3-4,9H2,1-2H3 |
| InChIKey | NCITWUPFLDFKKG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|