C13H10F3NO4 — CID 53378073
ethyl 2-(1,3-dioxoisoindol-2-yl)-3,3,3-trifluoropropanoate (PubChem CID 53378073) has the molecular formula C13H10F3NO4 and a molecular weight of 301.22 g/mol. Its IUPAC name is ethyl 2-(1,3-dioxoisoindol-2-yl)-3,3,3-trifluoropropanoate.
| Compound Name | ethyl 2-(1,3-dioxoisoindol-2-yl)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 53378073 |
| Molecular Formula | C13H10F3NO4 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | ethyl 2-(1,3-dioxoisoindol-2-yl)-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)C(N1C(=O)c2ccccc2C1=O)C(F)(F)F |
| InChI | InChI=1S/C13H10F3NO4/c1-2-21-12(20)9(13(14,15)16)17-10(18)7-5-3-4-6-8(7)11(17)19/h3-6,9H,2H2,1H3 |
| InChIKey | DCFLESAOOZXTIJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|