C12H10F3NO4S — CID 121001111
2-(1-ethylsulfonyl-2,2,2-trifluoroethyl)isoindole-1,3-dione (PubChem CID 121001111) has the molecular formula C12H10F3NO4S and a molecular weight of 321.28 g/mol. Its IUPAC name is 2-(1-ethylsulfonyl-2,2,2-trifluoroethyl)isoindole-1,3-dione.
| Compound Name | 2-(1-ethylsulfonyl-2,2,2-trifluoroethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 121001111 |
| Molecular Formula | C12H10F3NO4S |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2-(1-ethylsulfonyl-2,2,2-trifluoroethyl)isoindole-1,3-dione |
| SMILES | CCS(=O)(=O)C(N1C(=O)c2ccccc2C1=O)C(F)(F)F |
| InChI | InChI=1S/C12H10F3NO4S/c1-2-21(19,20)11(12(13,14)15)16-9(17)7-5-3-4-6-8(7)10(16)18/h3-6,11H,2H2,1H3 |
| InChIKey | LSNXGTPMIBUCSB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|