C12H8F3NO3 — CID 175903469
2-(1,3-dioxoisoindol-2-yl)-4,4,4-trifluorobutanal (PubChem CID 175903469) has the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-4,4,4-trifluorobutanal.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-4,4,4-trifluorobutanal |
|---|---|
| PubChem CID | 175903469 |
| Molecular Formula | C12H8F3NO3 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-4,4,4-trifluorobutanal |
| SMILES | O=CC(CC(F)(F)F)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H8F3NO3/c13-12(14,15)5-7(6-17)16-10(18)8-3-1-2-4-9(8)11(16)19/h1-4,6-7H,5H2 |
| InChIKey | QSTJAKCQTKEJDF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|