C13H14N2O4 — CID 145481860
(2R)-5-amino-2-(1,3-dioxoisoindol-2-yl)-5-hydroxypentanal (PubChem CID 145481860) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is (2R)-5-amino-2-(1,3-dioxoisoindol-2-yl)-5-hydroxypentanal.
| Compound Name | (2R)-5-amino-2-(1,3-dioxoisoindol-2-yl)-5-hydroxypentanal |
|---|---|
| PubChem CID | 145481860 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (2R)-5-amino-2-(1,3-dioxoisoindol-2-yl)-5-hydroxypentanal |
| SMILES | NC(O)CC[C@H](C=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H14N2O4/c14-11(17)6-5-8(7-16)15-12(18)9-3-1-2-4-10(9)13(15)19/h1-4,7-8,11,17H,5-6,14H2/t8-,11?/m1/s1 |
| InChIKey | DKPIBYQWSYGYPQ-RZZZFEHKSA-N |
| XLogP | -0.09 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|