C20H27NO4 — CID 101356122
(2S,3S)-4-butyl-2-(1,3-dioxoisoindol-2-yl)-3-hydroxyoctanal (PubChem CID 101356122) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (2S,3S)-4-butyl-2-(1,3-dioxoisoindol-2-yl)-3-hydroxyoctanal.
| Compound Name | (2S,3S)-4-butyl-2-(1,3-dioxoisoindol-2-yl)-3-hydroxyoctanal |
|---|---|
| PubChem CID | 101356122 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (2S,3S)-4-butyl-2-(1,3-dioxoisoindol-2-yl)-3-hydroxyoctanal |
| SMILES | CCCCC(CCCC)[C@H](O)[C@@H](C=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H27NO4/c1-3-5-9-14(10-6-4-2)18(23)17(13-22)21-19(24)15-11-7-8-12-16(15)20(21)25/h7-8,11-14,17-18,23H,3-6,9-10H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | DVZCTTQJEKNSLU-MSOLQXFVSA-N |
| XLogP | 3.21 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|