C17H22ClNO2 — CID 86194324
2-(4-chlorononan-5-yl)isoindole-1,3-dione (PubChem CID 86194324) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-(4-chlorononan-5-yl)isoindole-1,3-dione.
| Compound Name | 2-(4-chlorononan-5-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 86194324 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-(4-chlorononan-5-yl)isoindole-1,3-dione |
| SMILES | CCCCC(C(Cl)CCC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H22ClNO2/c1-3-5-11-15(14(18)8-4-2)19-16(20)12-9-6-7-10-13(12)17(19)21/h6-7,9-10,14-15H,3-5,8,11H2,1-2H3 |
| InChIKey | RQRWLFRGZFKXAD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|