C34H45N3O4 — CID 122368949
2-[2-(dihexylamino)-1-(1,3-dioxoisoindol-2-yl)hexyl]isoindole-1,3-dione (PubChem CID 122368949) has the molecular formula C34H45N3O4 and a molecular weight of 559.75 g/mol. Its IUPAC name is 2-[2-(dihexylamino)-1-(1,3-dioxoisoindol-2-yl)hexyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(dihexylamino)-1-(1,3-dioxoisoindol-2-yl)hexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122368949 |
| Molecular Formula | C34H45N3O4 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.34 |
| IUPAC Name | 2-[2-(dihexylamino)-1-(1,3-dioxoisoindol-2-yl)hexyl]isoindole-1,3-dione |
| SMILES | CCCCCCN(CCCCCC)C(CCCC)C(N1C(=O)c2ccccc2C1=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C34H45N3O4/c1-4-7-10-16-23-35(24-17-11-8-5-2)29(22-9-6-3)30(36-31(38)25-18-12-13-19-26(25)32(36)39)37-33(40)27-20-14-15-21-28(27)34(37)41/h12-15,18-21,29-30H,4-11,16-17,22-24H2,1-3H3 |
| InChIKey | BVUUFQHCKMOHAR-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|