C18H21NO3 — CID 101149693
2-(1-hydroxydec-2-yn-4-yl)isoindole-1,3-dione (PubChem CID 101149693) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-(1-hydroxydec-2-yn-4-yl)isoindole-1,3-dione.
| Compound Name | 2-(1-hydroxydec-2-yn-4-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 101149693 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-(1-hydroxydec-2-yn-4-yl)isoindole-1,3-dione |
| SMILES | CCCCCCC(C#CCO)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H21NO3/c1-2-3-4-5-9-14(10-8-13-20)19-17(21)15-11-6-7-12-16(15)18(19)22/h6-7,11-12,14,20H,2-5,9,13H2,1H3 |
| InChIKey | ULEUJJRYPFGFCS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|