C19H25F2NO3 — CID 12968542
2-[(3R)-2,2-difluoro-1-hydroxyundecan-3-yl]isoindole-1,3-dione (PubChem CID 12968542) has the molecular formula C19H25F2NO3 and a molecular weight of 353.41 g/mol. Its IUPAC name is 2-[(3R)-2,2-difluoro-1-hydroxyundecan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3R)-2,2-difluoro-1-hydroxyundecan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 12968542 |
| Molecular Formula | C19H25F2NO3 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2-[(3R)-2,2-difluoro-1-hydroxyundecan-3-yl]isoindole-1,3-dione |
| SMILES | CCCCCCCC[C@@H](N1C(=O)c2ccccc2C1=O)C(F)(F)CO |
| InChI | InChI=1S/C19H25F2NO3/c1-2-3-4-5-6-7-12-16(19(20,21)13-23)22-17(24)14-10-8-9-11-15(14)18(22)25/h8-11,16,23H,2-7,12-13H2,1H3/t16-/m1/s1 |
| InChIKey | MNYTVPOKFOIVJT-MRXNPFEDSA-N |
| XLogP | 4.03 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|