C18H21NO6 — CID 90770105
3-[1-(1,3-dioxoisoindol-2-yl)octyl]dioxirane-3-carboxylic acid (PubChem CID 90770105) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is 3-[1-(1,3-dioxoisoindol-2-yl)octyl]dioxirane-3-carboxylic acid.
| Compound Name | 3-[1-(1,3-dioxoisoindol-2-yl)octyl]dioxirane-3-carboxylic acid |
|---|---|
| PubChem CID | 90770105 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-[1-(1,3-dioxoisoindol-2-yl)octyl]dioxirane-3-carboxylic acid |
| SMILES | CCCCCCCC(N1C(=O)c2ccccc2C1=O)C1(C(=O)O)OO1 |
| InChI | InChI=1S/C18H21NO6/c1-2-3-4-5-6-11-14(18(17(22)23)24-25-18)19-15(20)12-9-7-8-10-13(12)16(19)21/h7-10,14H,2-6,11H2,1H3,(H,22,23) |
| InChIKey | XEVMMKQJZIZGPC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|