C16H21NO3 — CID 143996703
ethane;2-(2-oxohexan-3-yl)isoindole-1,3-dione (PubChem CID 143996703) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is ethane;2-(2-oxohexan-3-yl)isoindole-1,3-dione.
| Compound Name | ethane;2-(2-oxohexan-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 143996703 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | ethane;2-(2-oxohexan-3-yl)isoindole-1,3-dione |
| SMILES | CC.CCCC(C(C)=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H15NO3.C2H6/c1-3-6-12(9(2)16)15-13(17)10-7-4-5-8-11(10)14(15)18;1-2/h4-5,7-8,12H,3,6H2,1-2H3;1-2H3 |
| InChIKey | XBDGUEFZYMKUMB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|