(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid

C13H13NO5 — CID 102042590

IUPAC(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid
SMILESCOCC[C@H](C(=O)O)N1C(=O)c2ccccc2C1=O
InChIInChI=1S/C13H13NO5/c1-19-7-6-10(13(17)18)14-11(15)8-4-2-3-5-9(8)12(14)16/h2-5,10H,6-7H2,1H3,(H,17,18)/t10-/m1/s1
InChIKeyMVJSMCRXZUTZSG-SNVBAGLBSA-N
MW263.25 g/mol
LogP0.77
Rot. Bonds5

About (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid

(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid (PubChem CID 102042590) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid.

Molecular Properties

Compound Name(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid
PubChem CID102042590
Molecular FormulaC13H13NO5
Molecular Weight263.25 g/mol
Exact Mass263.08
IUPAC Name(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid
SMILESCOCC[C@H](C(=O)O)N1C(=O)c2ccccc2C1=O
InChIInChI=1S/C13H13NO5/c1-19-7-6-10(13(17)18)14-11(15)8-4-2-3-5-9(8)12(14)16/h2-5,10H,6-7H2,1H3,(H,17,18)/t10-/m1/s1
InChIKeyMVJSMCRXZUTZSG-SNVBAGLBSA-N
XLogP0.77
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.25
LogP ≤ 50.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid?
The IUPAC name of (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid (CID 102042590) is (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid.
What is the SMILES notation for (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid?
The canonical SMILES for (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid is COCC[C@H](C(=O)O)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid?
The InChIKey is MVJSMCRXZUTZSG-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H13NO5/c1-19-7-6-10(13(17)18)14-11(15)8-4-2-3-5-9(8)12(14)16/h2-5,10H,6-7H2,1H3,(H,17,18)/t10-/m1/s1.
What are the key properties of (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid?
(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid has a molecular weight of 263.25 g/mol, XLogP of 0.77, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methoxybutanoic acid is sourced from PubChem (CID 102042590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).