C15H18NO8P — CID 102466667
methyl 4-dimethoxyphosphoryloxy-2-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 102466667) has the molecular formula C15H18NO8P and a molecular weight of 371.28 g/mol. Its IUPAC name is methyl 4-dimethoxyphosphoryloxy-2-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | methyl 4-dimethoxyphosphoryloxy-2-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 102466667 |
| Molecular Formula | C15H18NO8P |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | methyl 4-dimethoxyphosphoryloxy-2-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | COC(=O)C(CCOP(=O)(OC)OC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H18NO8P/c1-21-15(19)12(8-9-24-25(20,22-2)23-3)16-13(17)10-6-4-5-7-11(10)14(16)18/h4-7,12H,8-9H2,1-3H3 |
| InChIKey | BGHMWUZZXSMDJS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|