C15H13N3O4 — CID 54174040
methyl 2-(1,3-dioxoisoindol-2-yl)-3-imidazol-1-ylpropanoate (PubChem CID 54174040) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is methyl 2-(1,3-dioxoisoindol-2-yl)-3-imidazol-1-ylpropanoate.
| Compound Name | methyl 2-(1,3-dioxoisoindol-2-yl)-3-imidazol-1-ylpropanoate |
|---|---|
| PubChem CID | 54174040 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | methyl 2-(1,3-dioxoisoindol-2-yl)-3-imidazol-1-ylpropanoate |
| SMILES | COC(=O)C(Cn1ccnc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H13N3O4/c1-22-15(21)12(8-17-7-6-16-9-17)18-13(19)10-4-2-3-5-11(10)14(18)20/h2-7,9,12H,8H2,1H3 |
| InChIKey | OWZQIQWXKOHODI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|