C13H11NO4 — CID 11096858
methyl (2S)-2-(1,3-dioxoisoindol-2-yl)but-3-enoate (PubChem CID 11096858) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is methyl (2S)-2-(1,3-dioxoisoindol-2-yl)but-3-enoate.
| Compound Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)but-3-enoate |
|---|---|
| PubChem CID | 11096858 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)but-3-enoate |
| SMILES | C=C[C@@H](C(=O)OC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H11NO4/c1-3-10(13(17)18-2)14-11(15)8-6-4-5-7-9(8)12(14)16/h3-7,10H,1H2,2H3/t10-/m0/s1 |
| InChIKey | UATOEQWGONWDLB-JTQLQIEISA-N |
| XLogP | 1.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|