C15H11NO4S — CID 54169263
methyl 2-(1,3-dioxoisoindol-2-yl)-2-thiophen-2-ylacetate (PubChem CID 54169263) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is methyl 2-(1,3-dioxoisoindol-2-yl)-2-thiophen-2-ylacetate.
| Compound Name | methyl 2-(1,3-dioxoisoindol-2-yl)-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 54169263 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | methyl 2-(1,3-dioxoisoindol-2-yl)-2-thiophen-2-ylacetate |
| SMILES | COC(=O)C(c1cccs1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H11NO4S/c1-20-15(19)12(11-7-4-8-21-11)16-13(17)9-5-2-3-6-10(9)14(16)18/h2-8,12H,1H3 |
| InChIKey | OTVWIBRFIACWLA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|